Products 103628-62-2
CAS 103628-62-2 is the registry number for Sumatriptan hydrochloride. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide;hydrochloride (CAS 103628-62-2) is a chemical compound with the molecular formula C14H22ClN3O2S and a molecular weight of 331.9 g/mol. IUPAC name: 1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide;hydrochloride. InChIKey: JUVOYQBBBAMFPX-UHFFFAOYSA-N.
| Molecular formula | C14H22ClN3O2S |
|---|---|
| Molecular weight | 331.9 g/mol |
| IUPAC name | 1-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide;hydrochloride |
| InChIKey | JUVOYQBBBAMFPX-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC2=C(C=C1)NC=C2CCN(C)C.Cl |
Computed by PubChem (NCBI)