CAS 1036546-99-2 appears in our catalog under these names: 1-[4-(aminomethyl)phenyl]-N-tert-butylmethanesulfonamide, 95%, 1-(4-(Aminomethyl)phenyl)-N-tert-butylmethanesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-[4-(aminomethyl)phenyl]-N-tert-butylmethanesulfonamide (CAS 1036546-99-2) is a chemical compound with the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. IUPAC name: 1-[4-(aminomethyl)phenyl]-N-tert-butylmethanesulfonamide. InChIKey: HTMFFZFHEDTURN-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2S |
|---|---|
| Molecular weight | 256.37 g/mol |
| IUPAC name | 1-[4-(aminomethyl)phenyl]-N-tert-butylmethanesulfonamide |
| InChIKey | HTMFFZFHEDTURN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)CC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)