Products 1036571-81-9
CAS 1036571-81-9 is the registry number for 5-(N-Cyclohexylsulfamoyl)thiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(cyclohexylsulfamoyl)thiophene-3-carboxylic acid (CAS 1036571-81-9) is a chemical compound with the molecular formula C11H15NO4S2 and a molecular weight of 289.4 g/mol. IUPAC name: 5-(cyclohexylsulfamoyl)thiophene-3-carboxylic acid. InChIKey: VEKRJGYMOXWAQO-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S2 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 5-(cyclohexylsulfamoyl)thiophene-3-carboxylic acid |
| InChIKey | VEKRJGYMOXWAQO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC(=CS2)C(=O)O |
Computed by PubChem (NCBI)