CAS 1036577-87-3 appears in our catalog under these names: 2,6-Dichloro-3-((propan-2-yl)sulfamoyl)benzoic acid, 95%, 2,6-Dichloro-3-((propan-2-yl)sulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2,6-dichloro-3-(propan-2-ylsulfamoyl)benzoic acid (CAS 1036577-87-3) is a chemical compound with the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. IUPAC name: 2,6-dichloro-3-(propan-2-ylsulfamoyl)benzoic acid. InChIKey: BCASULWFHPZNBV-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO4S |
|---|---|
| Molecular weight | 312.17 g/mol |
| IUPAC name | 2,6-dichloro-3-(propan-2-ylsulfamoyl)benzoic acid |
| InChIKey | BCASULWFHPZNBV-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=C(C(=C(C=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)