CAS 1036755-87-9 is the registry number for 6-Bromo-2,5-dichloro-8-methoxyquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-2,5-dichloro-8-methoxyquinazoline (CAS 1036755-87-9) is a chemical compound with the molecular formula C9H5BrCl2N2O and a molecular weight of 307.96 g/mol. IUPAC name: 6-bromo-2,5-dichloro-8-methoxyquinazoline. InChIKey: YQYQZNSPBAPDSG-UHFFFAOYSA-N.
| Molecular formula | C9H5BrCl2N2O |
|---|---|
| Molecular weight | 307.96 g/mol |
| IUPAC name | 6-bromo-2,5-dichloro-8-methoxyquinazoline |
| InChIKey | YQYQZNSPBAPDSG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=CN=C(N=C12)Cl)Cl)Br |
Computed by PubChem (NCBI)