CAS 1037092-93-5 is the registry number for BR111. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid (CAS 1037092-93-5) is a chemical compound with the molecular formula C24H26N4O3S and a molecular weight of 450.6 g/mol. IUPAC name: (2S)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid. InChIKey: XYFDAJRUBYOTRD-SFHVURJKSA-N.
| Molecular formula | C24H26N4O3S |
|---|---|
| Molecular weight | 450.6 g/mol |
| IUPAC name | (2S)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | XYFDAJRUBYOTRD-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(S3)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)