CAS 1037131-77-3 appears in our catalog under these names: (1-(3-Fluorophenyl)cyclobutyl)methanamine, (1-(3-Fluorophenyl)cyclobutyl)methanamine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 5g, 1g, 250mg, 10g.
[1-(3-fluorophenyl)cyclobutyl]methanamine (CAS 1037131-77-3) is a chemical compound with the molecular formula C11H14FN and a molecular weight of 179.23 g/mol. IUPAC name: [1-(3-fluorophenyl)cyclobutyl]methanamine. InChIKey: QVKLJTPSPVHTRP-UHFFFAOYSA-N.
| Molecular formula | C11H14FN |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | [1-(3-fluorophenyl)cyclobutyl]methanamine |
| InChIKey | QVKLJTPSPVHTRP-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)