CAS 1037298-12-6 is the registry number for 5-Bromo-4-fluoro-2-hydroxy-aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-4-bromo-5-fluorophenol;hydrochloride (CAS 1037298-12-6) is a chemical compound with the molecular formula C6H6BrClFNO and a molecular weight of 242.47 g/mol. IUPAC name: 2-amino-4-bromo-5-fluorophenol;hydrochloride. InChIKey: CXNQELBTUKLEBK-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClFNO |
|---|---|
| Molecular weight | 242.47 g/mol |
| IUPAC name | 2-amino-4-bromo-5-fluorophenol;hydrochloride |
| InChIKey | CXNQELBTUKLEBK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)O)N.Cl |
Computed by PubChem (NCBI)