CAS 1037397-00-4 is the registry number for (Z)-N-(Pyridin-4-ylmethylene)methanamine oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-methyl-1-pyridin-4-ylmethanimine oxide (CAS 1037397-00-4) is a chemical compound with the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. IUPAC name: N-methyl-1-pyridin-4-ylmethanimine oxide. InChIKey: XRVXMGGFNHTYFU-TWGQIWQCSA-N.
| Molecular formula | C7H8N2O |
|---|---|
| Molecular weight | 136.15 g/mol |
| IUPAC name | N-methyl-1-pyridin-4-ylmethanimine oxide |
| InChIKey | XRVXMGGFNHTYFU-TWGQIWQCSA-N |
| SMILES | C/[N+](=C/C1=CC=NC=C1)/[O-] |
Computed by PubChem (NCBI)