Products 1037397-00-4

CAS 1037397-00-4 is the registry number for (Z)-N-(Pyridin-4-ylmethylene)methanamine oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

N-methyl-1-pyridin-4-ylmethanimine oxide (CAS 1037397-00-4) is a chemical compound with the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. IUPAC name: N-methyl-1-pyridin-4-ylmethanimine oxide. InChIKey: XRVXMGGFNHTYFU-TWGQIWQCSA-N.

Identity
Molecular formulaC7H8N2O
Molecular weight136.15 g/mol
IUPAC nameN-methyl-1-pyridin-4-ylmethanimine oxide
InChIKeyXRVXMGGFNHTYFU-TWGQIWQCSA-N
SMILESC/[N+](=C/C1=CC=NC=C1)/[O-]

Computed by PubChem (NCBI)