CAS 10375-34-5 appears in our catalog under these names: 2,5-Furandicarbonyl dichloride, 95%, 2,5–Furandicarbonyldichloride, 2,5-Furandicarbonyl Dichloride, >98.0%(GC), 2,5-Furandicarbonyl Dichloride 98% GC, 2,5-Furandicarbonyl Dichloride, 98% GC, 98% GC. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 100g, 500g.
Furan-2,5-dicarbonyl chloride (CAS 10375-34-5) is a chemical compound with the molecular formula C6H2Cl2O3 and a molecular weight of 192.98 g/mol. IUPAC name: furan-2,5-dicarbonyl chloride. InChIKey: PDSULNVJASBMLP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2O3 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | furan-2,5-dicarbonyl chloride |
| InChIKey | PDSULNVJASBMLP-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)