CAS 103752-77-8 is the registry number for 2-(3-Chlorophenyl)-N,N-dimethylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.
2-(3-chlorophenyl)-N,N-dimethylacetamide (CAS 103752-77-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-(3-chlorophenyl)-N,N-dimethylacetamide. InChIKey: JUZWVIWMTKAKFY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-N,N-dimethylacetamide |
| InChIKey | JUZWVIWMTKAKFY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)