CAS 103772-14-1 is the registry number for Sparfloxacin Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid (CAS 103772-14-1) is a chemical compound with the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. IUPAC name: 5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: CQPUZLMNORVQPG-UHFFFAOYSA-N.
| Molecular formula | C13H9F3N2O3 |
|---|---|
| Molecular weight | 298.22 g/mol |
| IUPAC name | 5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | CQPUZLMNORVQPG-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C(C(=O)C3=C(C(=C(C(=C32)F)F)F)N)C(=O)O |
Computed by PubChem (NCBI)