CAS 103775-75-3 is the registry number for Miboplatin. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 25mg, Get quote.
Cyclobutane-1,1-dicarboxylate;platinum(2+);[(2R)-pyrrolidin-2-yl]methanamine (CAS 103775-75-3) is a chemical compound with the molecular formula C11H18N2O4Pt and a molecular weight of 437.36 g/mol. IUPAC name: cyclobutane-1,1-dicarboxylate;platinum(2+);[(2R)-pyrrolidin-2-yl]methanamine. InChIKey: XXUHLUDUCZQMDI-UTYJZAQGSA-L.
| Molecular formula | C11H18N2O4Pt |
|---|---|
| Molecular weight | 437.36 g/mol |
| IUPAC name | cyclobutane-1,1-dicarboxylate;platinum(2+);[(2R)-pyrrolidin-2-yl]methanamine |
| InChIKey | XXUHLUDUCZQMDI-UTYJZAQGSA-L |
| SMILES | C1C[C@@H](NC1)CN.C1CC(C1)(C(=O)[O-])C(=O)[O-].[Pt+2] |
Computed by PubChem (NCBI)