CAS 1038094-94-8 is the registry number for α-Amylase/α-Glucosidase-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(4-chlorophenyl)-1,3,4-oxadiazole (CAS 1038094-94-8) is a chemical compound with the molecular formula C15H9Cl2FN2OS and a molecular weight of 355.2 g/mol. IUPAC name: 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(4-chlorophenyl)-1,3,4-oxadiazole. InChIKey: IURPVJLZLUKWTA-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2FN2OS |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(4-chlorophenyl)-1,3,4-oxadiazole |
| InChIKey | IURPVJLZLUKWTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)SCC3=C(C=C(C=C3)F)Cl)Cl |
Computed by PubChem (NCBI)