CAS 10385-36-1 appears in our catalog under these names: 1-Bromo-2,3,4-trimethoxybenzene 97%, 1-Bromo-2,3,4-trimethoxybenzene, 97%, 1-Bromo-2,3,4-trimethoxybenzene, 97%, 97%, 2,3,4–(Trimethoxy)bromobenzene. Offered by: Ambeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 1g, 5g, 25g, 250mg.
1-bromo-2,3,4-trimethoxybenzene (CAS 10385-36-1) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: 1-bromo-2,3,4-trimethoxybenzene. InChIKey: HKCQJLVIFMFOTG-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 1-bromo-2,3,4-trimethoxybenzene |
| InChIKey | HKCQJLVIFMFOTG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)OC |
Computed by PubChem (NCBI)