CAS 1038509-56-6 appears in our catalog under these names: (1S,3S,5S)-tert-Butyl 3-(aminomethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate, 95%, tert-butyl (1S,3S,5S)-3-(aminomethyl)-2-azabicyclo(3.1.0)hexane-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
Tert-butyl (1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1038509-56-6) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: ZBNRVIGHEROTFW-VGMNWLOBSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | ZBNRVIGHEROTFW-VGMNWLOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C[C@H]2[C@@H]1C2)CN |
Computed by PubChem (NCBI)