Products 103905-49-3
CAS 103905-49-3 appears in our catalog under these names: 4-(Dimethylaminomethyl)-6-fluoro-2-methoxyphenol, 95%, 4-(Dimethylaminomethyl)-6-fluoro-2-methoxyphenol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
4-[(dimethylamino)methyl]-2-fluoro-6-methoxyphenol (CAS 103905-49-3) is a chemical compound with the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. IUPAC name: 4-[(dimethylamino)methyl]-2-fluoro-6-methoxyphenol. InChIKey: NOTMCGGOLLFMRG-UHFFFAOYSA-N.
| Molecular formula | C10H14FNO2 |
|---|---|
| Molecular weight | 199.22 g/mol |
| IUPAC name | 4-[(dimethylamino)methyl]-2-fluoro-6-methoxyphenol |
| InChIKey | NOTMCGGOLLFMRG-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=C(C(=C1)F)O)OC |
Computed by PubChem (NCBI)