Products 103918-73-6

CAS 103918-73-6 is the registry number for 2-Phenylthio-5-propionylphenylacetic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 1g, 25g.

Structural formula: {0} (CAS {1})

2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid (CAS 103918-73-6) is a chemical compound with the molecular formula C17H16O3S and a molecular weight of 300.4 g/mol. IUPAC name: 2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid. InChIKey: OIDXFJQJYOGXHS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16O3S
Molecular weight300.4 g/mol
IUPAC name2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid
InChIKeyOIDXFJQJYOGXHS-UHFFFAOYSA-N
SMILESCCC(=O)C1=CC(=C(C=C1)SC2=CC=CC=C2)CC(=O)O

Computed by PubChem (NCBI)