CAS 103918-73-6 is the registry number for 2-Phenylthio-5-propionylphenylacetic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 1g, 25g.
2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid (CAS 103918-73-6) is a chemical compound with the molecular formula C17H16O3S and a molecular weight of 300.4 g/mol. IUPAC name: 2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid. InChIKey: OIDXFJQJYOGXHS-UHFFFAOYSA-N.
| Molecular formula | C17H16O3S |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid |
| InChIKey | OIDXFJQJYOGXHS-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)SC2=CC=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)