Products 1039307-95-3

CAS 1039307-95-3 is the registry number for Valsartan Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid (CAS 1039307-95-3) is a chemical compound with the molecular formula C18H21NO2 and a molecular weight of 283.4 g/mol. IUPAC name: (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid. InChIKey: WQQLDAFJPWYZCC-DYVFJYSZSA-N.

Identity
Molecular formulaC18H21NO2
Molecular weight283.4 g/mol
IUPAC name(2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid
InChIKeyWQQLDAFJPWYZCC-DYVFJYSZSA-N
SMILESC[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N)C(=O)O

Computed by PubChem (NCBI)