CAS 1039334-55-8 appears in our catalog under these names: 4-(2,4-Dichlorophenoxy)-3-fluoroaniline, 95%, 4-(2,4-Dichlorophenoxy)-3-fluoroaniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(2,4-dichlorophenoxy)-3-fluoroaniline (CAS 1039334-55-8) is a chemical compound with the molecular formula C12H8Cl2FNO and a molecular weight of 272.10 g/mol. IUPAC name: 4-(2,4-dichlorophenoxy)-3-fluoroaniline. InChIKey: ATSXMWISGAYPBK-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2FNO |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | 4-(2,4-dichlorophenoxy)-3-fluoroaniline |
| InChIKey | ATSXMWISGAYPBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)