CAS 1039364-45-8 is the registry number for 4-Chloro-2-iodopyrrolo[1,2-f][1,2,4]triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
4-chloro-2-iodopyrrolo[2,1-f][1,2,4]triazine (CAS 1039364-45-8) is a chemical compound with the molecular formula C6H3ClIN3 and a molecular weight of 279.46 g/mol. IUPAC name: 4-chloro-2-iodopyrrolo[2,1-f][1,2,4]triazine. InChIKey: ACSUHYOSODMNIG-UHFFFAOYSA-N.
| Molecular formula | C6H3ClIN3 |
|---|---|
| Molecular weight | 279.46 g/mol |
| IUPAC name | 4-chloro-2-iodopyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | ACSUHYOSODMNIG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=NC(=N2)I)Cl |
Computed by PubChem (NCBI)