CAS 103963-67-3 appears in our catalog under these names: Lithium 2-oxo-3-sulfonatopropanoate, 98%, Sulfopyruvic Acid Dilithium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Dilithium;2-oxo-3-sulfonatopropanoate (CAS 103963-67-3) is a chemical compound with the molecular formula C3H2Li2O6S and a molecular weight of 180.0 g/mol. IUPAC name: dilithium;2-oxo-3-sulfonatopropanoate. InChIKey: NIEJKPZDXGXZCD-UHFFFAOYSA-L.
| Molecular formula | C3H2Li2O6S |
|---|---|
| Molecular weight | 180.0 g/mol |
| IUPAC name | dilithium;2-oxo-3-sulfonatopropanoate |
| InChIKey | NIEJKPZDXGXZCD-UHFFFAOYSA-L |
| SMILES | [Li+].[Li+].C(C(=O)C(=O)[O-])S(=O)(=O)[O-] |
Computed by PubChem (NCBI)