CAS 103972-83-4 appears in our catalog under these names: H–Gly–Gly–Asp–Ala–OH, H-Gly-Gly-Asp-Ala-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 2000mg.
(3S)-3-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-[[(1S)-1-carboxyethyl]amino]-4-oxobutanoic acid (CAS 103972-83-4) is a chemical compound with the molecular formula C11H18N4O7 and a molecular weight of 318.28 g/mol. IUPAC name: (3S)-3-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-[[(1S)-1-carboxyethyl]amino]-4-oxobutanoic acid. InChIKey: CHWINHPRRHRUPJ-WDSKDSINSA-N.
| Molecular formula | C11H18N4O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | (3S)-3-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-[[(1S)-1-carboxyethyl]amino]-4-oxobutanoic acid |
| InChIKey | CHWINHPRRHRUPJ-WDSKDSINSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)