CAS 103993-36-8 is the registry number for Hydro Idebenone 10’-Carboxylate 1-O-Sulfate Dipotassium Salt. Offered by: TRC. Available pack sizes: 75mg.
Dipotassium;10-(3-hydroxy-4,5-dimethoxy-2-methyl-6-sulfonatooxyphenyl)decanoate (CAS 103993-36-8) is a chemical compound with the molecular formula C19H28K2O9S and a molecular weight of 510.7 g/mol. IUPAC name: dipotassium;10-(3-hydroxy-4,5-dimethoxy-2-methyl-6-sulfonatooxyphenyl)decanoate. InChIKey: CDYJFTOUVXWUTA-UHFFFAOYSA-L.
| Molecular formula | C19H28K2O9S |
|---|---|
| Molecular weight | 510.7 g/mol |
| IUPAC name | dipotassium;10-(3-hydroxy-4,5-dimethoxy-2-methyl-6-sulfonatooxyphenyl)decanoate |
| InChIKey | CDYJFTOUVXWUTA-UHFFFAOYSA-L |
| SMILES | CC1=C(C(=C(C(=C1O)OC)OC)OS(=O)(=O)[O-])CCCCCCCCCC(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)