CAS 1039930-45-4 is the registry number for Methyl 2,4-dioxo-4-(3-(trifluoromethyl)phenyl)butanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate (CAS 1039930-45-4) is a chemical compound with the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. IUPAC name: methyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate. InChIKey: XJPMUDSQYXCHOC-UHFFFAOYSA-N.
| Molecular formula | C12H9F3O4 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate |
| InChIKey | XJPMUDSQYXCHOC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)