Products 1039930-45-4

CAS 1039930-45-4 is the registry number for Methyl 2,4-dioxo-4-(3-(trifluoromethyl)phenyl)butanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate (CAS 1039930-45-4) is a chemical compound with the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. IUPAC name: methyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate. InChIKey: XJPMUDSQYXCHOC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F3O4
Molecular weight274.19 g/mol
IUPAC namemethyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate
InChIKeyXJPMUDSQYXCHOC-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)CC(=O)C1=CC(=CC=C1)C(F)(F)F

Computed by PubChem (NCBI)