CAS 1039941-26-8 is the registry number for 4-tert-Butoxy-3-fluoroaniline, 90%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
3-fluoro-4-[(2-methylpropan-2-yl)oxy]aniline (CAS 1039941-26-8) is a chemical compound with the molecular formula C10H14FNO and a molecular weight of 183.22 g/mol. IUPAC name: 3-fluoro-4-[(2-methylpropan-2-yl)oxy]aniline. InChIKey: AIQNVLMXQIDZMI-UHFFFAOYSA-N.
| Molecular formula | C10H14FNO |
|---|---|
| Molecular weight | 183.22 g/mol |
| IUPAC name | 3-fluoro-4-[(2-methylpropan-2-yl)oxy]aniline |
| InChIKey | AIQNVLMXQIDZMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)