Products 1039981-89-9
CAS 1039981-89-9 appears in our catalog under these names: 2-Amino-3-fluoro-6-methylbenzoic acid, 95%, 2-amino-3-fluoro-6-methylbenzoic acid, 2-Amino-3-fluoro-6-methylbenzoic acid, 95%, 95%, 2-AMINO-3-FLUORO-6-METHYLBENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
2-amino-3-fluoro-6-methylbenzoic acid (CAS 1039981-89-9) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: 2-amino-3-fluoro-6-methylbenzoic acid. InChIKey: IQPXEMQKUBIGKY-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | 2-amino-3-fluoro-6-methylbenzoic acid |
| InChIKey | IQPXEMQKUBIGKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)N)C(=O)O |
Computed by PubChem (NCBI)