CAS 1040281-99-9 is the registry number for 2-(3-Bromo-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
2-(3-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1040281-99-9) is a chemical compound with the molecular formula C10H14BBrO2S and a molecular weight of 289.00 g/mol. IUPAC name: 2-(3-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VIVQMYMMLIMKNU-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO2S |
|---|---|
| Molecular weight | 289.00 g/mol |
| IUPAC name | 2-(3-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VIVQMYMMLIMKNU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)