CAS 104030-31-1 appears in our catalog under these names: (2E)-2-(1H-1,3-Benzodiazol-2-yl)-3-(thiophen-2-yl)prop-2-enenitrile, 95%, (2E)-2-(1H-1,3-Benzodiazol-2-yl)-3-(thiophen-2-yl)prop-2-enenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(E)-2-(1H-benzimidazol-2-yl)-3-thiophen-2-ylprop-2-enenitrile (CAS 104030-31-1) is a chemical compound with the molecular formula C14H9N3S and a molecular weight of 251.31 g/mol. IUPAC name: (E)-2-(1H-benzimidazol-2-yl)-3-thiophen-2-ylprop-2-enenitrile. InChIKey: MDVSLHGZTWHJMW-CSKARUKUSA-N.
| Molecular formula | C14H9N3S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | (E)-2-(1H-benzimidazol-2-yl)-3-thiophen-2-ylprop-2-enenitrile |
| InChIKey | MDVSLHGZTWHJMW-CSKARUKUSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)/C(=C/C3=CC=CS3)/C#N |
Computed by PubChem (NCBI)