CAS 1040321-56-9 is the registry number for 4-(2,3-Dimethylphenyl)-5-(thiophen-2-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2,3-dimethylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (CAS 1040321-56-9) is a chemical compound with the molecular formula C14H13N3S2 and a molecular weight of 287.4 g/mol. IUPAC name: 4-(2,3-dimethylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione. InChIKey: NBKPCJQGYKZWRC-UHFFFAOYSA-N.
| Molecular formula | C14H13N3S2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 4-(2,3-dimethylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | NBKPCJQGYKZWRC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N2C(=NNC2=S)C3=CC=CS3)C |
Computed by PubChem (NCBI)