Products 1040349-01-6

CAS 1040349-01-6 is the registry number for 5-((2-Fluorobenzyl)oxy)-4-oxo-4H-pyran-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[(2-fluorophenyl)methoxy]-4-oxopyran-2-carboxylic acid (CAS 1040349-01-6) is a chemical compound with the molecular formula C13H9FO5 and a molecular weight of 264.20 g/mol. IUPAC name: 5-[(2-fluorophenyl)methoxy]-4-oxopyran-2-carboxylic acid. InChIKey: HVZGXDFLINPZBO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9FO5
Molecular weight264.20 g/mol
IUPAC name5-[(2-fluorophenyl)methoxy]-4-oxopyran-2-carboxylic acid
InChIKeyHVZGXDFLINPZBO-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)COC2=COC(=CC2=O)C(=O)O)F

Computed by PubChem (NCBI)