CAS 1040390-19-9 appears in our catalog under these names: 2,5-Dibromothiazolo[5,4-d]thiazole, >95%, >95%, 2,5-Dibromothiazolo[5,4-d]thiazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 50mg.
2,5-dibromo-[1,3]thiazolo[5,4-d][1,3]thiazole (CAS 1040390-19-9) is a chemical compound with the molecular formula C4Br2N2S2 and a molecular weight of 300.0 g/mol. IUPAC name: 2,5-dibromo-[1,3]thiazolo[5,4-d][1,3]thiazole. InChIKey: MSUPZGGVRIRXAI-UHFFFAOYSA-N.
| Molecular formula | C4Br2N2S2 |
|---|---|
| Molecular weight | 300.0 g/mol |
| IUPAC name | 2,5-dibromo-[1,3]thiazolo[5,4-d][1,3]thiazole |
| InChIKey | MSUPZGGVRIRXAI-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(S1)Br)SC(=N2)Br |
Computed by PubChem (NCBI)