CAS 1040516-00-4 is the registry number for Dimethyl 4,4''-dibromo-[1,1':4',1''-terphenyl]-2,2''-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-2-[4-(4-bromo-2-methoxycarbonylphenyl)phenyl]benzoate (CAS 1040516-00-4) is a chemical compound with the molecular formula C22H16Br2O4 and a molecular weight of 504.2 g/mol. IUPAC name: methyl 5-bromo-2-[4-(4-bromo-2-methoxycarbonylphenyl)phenyl]benzoate. InChIKey: KTDIJHHOIJDSMR-UHFFFAOYSA-N.
| Molecular formula | C22H16Br2O4 |
|---|---|
| Molecular weight | 504.2 g/mol |
| IUPAC name | methyl 5-bromo-2-[4-(4-bromo-2-methoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | KTDIJHHOIJDSMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)C2=CC=C(C=C2)C3=C(C=C(C=C3)Br)C(=O)OC |
Computed by PubChem (NCBI)