CAS 2304559-58-6 is the registry number for 4,4'-(((2,5-Dibromo-1,4-phenylene)bis(methylene))bis(oxy))dibenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[2,5-dibromo-4-[(4-formylphenoxy)methyl]phenyl]methoxy]benzaldehyde (CAS 2304559-58-6) is a chemical compound with the molecular formula C22H16Br2O4 and a molecular weight of 504.2 g/mol. IUPAC name: 4-[[2,5-dibromo-4-[(4-formylphenoxy)methyl]phenyl]methoxy]benzaldehyde. InChIKey: KAGGABIOYGPBGF-UHFFFAOYSA-N.
| Molecular formula | C22H16Br2O4 |
|---|---|
| Molecular weight | 504.2 g/mol |
| IUPAC name | 4-[[2,5-dibromo-4-[(4-formylphenoxy)methyl]phenyl]methoxy]benzaldehyde |
| InChIKey | KAGGABIOYGPBGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OCC2=CC(=C(C=C2Br)COC3=CC=C(C=C3)C=O)Br |
Computed by PubChem (NCBI)