CAS 104068-43-1 is the registry number for Cyclo(Ile-Val). Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg, 100mg, Get quote.
3-butan-2-yl-6-propan-2-ylpiperazine-2,5-dione (CAS 104068-43-1) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: 3-butan-2-yl-6-propan-2-ylpiperazine-2,5-dione. InChIKey: XIQXUFYJMBDYSU-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 3-butan-2-yl-6-propan-2-ylpiperazine-2,5-dione |
| InChIKey | XIQXUFYJMBDYSU-UHFFFAOYSA-N |
| SMILES | CCC(C)C1C(=O)NC(C(=O)N1)C(C)C |
Computed by PubChem (NCBI)