CAS 104068-56-6 is the registry number for Curzeone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(8S)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one (CAS 104068-56-6) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: (8S)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one. InChIKey: YBJIFGYQRRWWFW-QMMMGPOBSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | (8S)-1,5,8-trimethyl-7,8-dihydro-6H-benzo[e][1]benzofuran-9-one |
| InChIKey | YBJIFGYQRRWWFW-QMMMGPOBSA-N |
| SMILES | C[C@H]1CCC2=C(C1=O)C3=C(C=C2C)OC=C3C |
Computed by PubChem (NCBI)