Products 1040682-15-2

CAS 1040682-15-2 is the registry number for 3-(3,5-Bis-Methanesulfonylphenyl)propionic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid (CAS 1040682-15-2) is a chemical compound with the molecular formula C11H14O6S2 and a molecular weight of 306.4 g/mol. IUPAC name: 3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid. InChIKey: DTJJZJJHGDFFBO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O6S2
Molecular weight306.4 g/mol
IUPAC name3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid
InChIKeyDTJJZJJHGDFFBO-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=CC(=C1)CCC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)