CAS 1040682-15-2 is the registry number for 3-(3,5-Bis-Methanesulfonylphenyl)propionic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid (CAS 1040682-15-2) is a chemical compound with the molecular formula C11H14O6S2 and a molecular weight of 306.4 g/mol. IUPAC name: 3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid. InChIKey: DTJJZJJHGDFFBO-UHFFFAOYSA-N.
| Molecular formula | C11H14O6S2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-[3,5-bis(methylsulfonyl)phenyl]propanoic acid |
| InChIKey | DTJJZJJHGDFFBO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)CCC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)