CAS 104086-76-2 is the registry number for 2',3'-Dideoxycytidine 5'-monophosphate. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 104086-76-2) is a chemical compound with the molecular formula C9H14N3O6P and a molecular weight of 291.20 g/mol. IUPAC name: [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: RAJMXAZJKUGYGW-POYBYMJQSA-N.
| Molecular formula | C9H14N3O6P |
|---|---|
| Molecular weight | 291.20 g/mol |
| IUPAC name | [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | RAJMXAZJKUGYGW-POYBYMJQSA-N |
| SMILES | C1C[C@@H](O[C@@H]1COP(=O)(O)O)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)