Products 104086-76-2

CAS 104086-76-2 is the registry number for 2',3'-Dideoxycytidine 5'-monophosphate. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 104086-76-2) is a chemical compound with the molecular formula C9H14N3O6P and a molecular weight of 291.20 g/mol. IUPAC name: [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: RAJMXAZJKUGYGW-POYBYMJQSA-N.

Identity
Molecular formulaC9H14N3O6P
Molecular weight291.20 g/mol
IUPAC name[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate
InChIKeyRAJMXAZJKUGYGW-POYBYMJQSA-N
SMILESC1C[C@@H](O[C@@H]1COP(=O)(O)O)N2C=CC(=NC2=O)N

Computed by PubChem (NCBI)