Products 1040920-70-4
CAS 1040920-70-4 is the registry number for 2-Nitrophenyl 2,3,4-tri-O-acetyl-b-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 500mg, 100mg.
[(3S,4R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxan-3-yl] acetate (CAS 1040920-70-4) is a chemical compound with the molecular formula C18H21NO11 and a molecular weight of 427.4 g/mol. IUPAC name: [(3S,4R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxan-3-yl] acetate. InChIKey: NXFUGQMYDWVNCD-USFGWYQBSA-N.
| Molecular formula | C18H21NO11 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [(3S,4R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxan-3-yl] acetate |
| InChIKey | NXFUGQMYDWVNCD-USFGWYQBSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](C([C@@H](OC1CO)OC2=CC=CC=C2[N+](=O)[O-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)