CAS 104113-95-3 is the registry number for N-Methyl Fenoldopam Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
9-chloro-5-(4-hydroxyphenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride (CAS 104113-95-3) is a chemical compound with the molecular formula C17H19Cl2NO3 and a molecular weight of 356.2 g/mol. IUPAC name: 9-chloro-5-(4-hydroxyphenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride. InChIKey: YJGGPTFGAQRAOX-UHFFFAOYSA-N.
| Molecular formula | C17H19Cl2NO3 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 9-chloro-5-(4-hydroxyphenyl)-3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride |
| InChIKey | YJGGPTFGAQRAOX-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C(=C(C=C2C(C1)C3=CC=C(C=C3)O)O)O)Cl.Cl |
Computed by PubChem (NCBI)