Products 104142-66-7

CAS 104142-66-7 is the registry number for Chlorooxoacetic acid 2-chloroallyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloroprop-2-enyl 2-chloro-2-oxoacetate (CAS 104142-66-7) is a chemical compound with the molecular formula C5H4Cl2O3 and a molecular weight of 182.99 g/mol. IUPAC name: 2-chloroprop-2-enyl 2-chloro-2-oxoacetate. InChIKey: DROVKFBGHINOBG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4Cl2O3
Molecular weight182.99 g/mol
IUPAC name2-chloroprop-2-enyl 2-chloro-2-oxoacetate
InChIKeyDROVKFBGHINOBG-UHFFFAOYSA-N
SMILESC=C(COC(=O)C(=O)Cl)Cl

Computed by PubChem (NCBI)