CAS 104142-93-0 appears in our catalog under these names: Norfloxacin hydrochloride(1:x), 97%, Norfloxacin hydrochloride(1:x), 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g.
1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride (CAS 104142-93-0) is a chemical compound with the molecular formula C16H19ClFN3O3 and a molecular weight of 355.79 g/mol. IUPAC name: 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride. InChIKey: JJWDELPVPRCLQN-UHFFFAOYSA-N.
| Molecular formula | C16H19ClFN3O3 |
|---|---|
| Molecular weight | 355.79 g/mol |
| IUPAC name | 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | JJWDELPVPRCLQN-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O.Cl |
Computed by PubChem (NCBI)