CAS 1041434-13-2 appears in our catalog under these names: 3,5-Dicarboxyphenylboronic acid, pinacol ester, 96%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isophthalic acid, 95%, 95%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isophthalic acid, 95%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isophthalic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 10g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylic acid (CAS 1041434-13-2) is a chemical compound with the molecular formula C14H17BO6 and a molecular weight of 292.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylic acid. InChIKey: SHOCDYNDBPODHQ-UHFFFAOYSA-N.
| Molecular formula | C14H17BO6 |
|---|---|
| Molecular weight | 292.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | SHOCDYNDBPODHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)