Products 1041507-44-1
CAS 1041507-44-1 is the registry number for 6-Chloro-N-(3,5-difluorophenyl)pyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-N-(3,5-difluorophenyl)pyridine-3-sulfonamide (CAS 1041507-44-1) is a chemical compound with the molecular formula C11H7ClF2N2O2S and a molecular weight of 304.70 g/mol. IUPAC name: 6-chloro-N-(3,5-difluorophenyl)pyridine-3-sulfonamide. InChIKey: ZELDSFGYLFYTNE-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF2N2O2S |
|---|---|
| Molecular weight | 304.70 g/mol |
| IUPAC name | 6-chloro-N-(3,5-difluorophenyl)pyridine-3-sulfonamide |
| InChIKey | ZELDSFGYLFYTNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)NC2=CC(=CC(=C2)F)F)Cl |
Computed by PubChem (NCBI)