CAS 1041538-12-8 appears in our catalog under these names: 4-Bromo-N-{(4-(trifluoromethyl)phenyl)methyl}aniline, 95%, 4-Bromo-N-{(4-(trifluoromethyl)phenyl)methyl}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]aniline (CAS 1041538-12-8) is a chemical compound with the molecular formula C14H11BrF3N and a molecular weight of 330.14 g/mol. IUPAC name: 4-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]aniline. InChIKey: IDLCOISEYAOIIL-UHFFFAOYSA-N.
| Molecular formula | C14H11BrF3N |
|---|---|
| Molecular weight | 330.14 g/mol |
| IUPAC name | 4-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]aniline |
| InChIKey | IDLCOISEYAOIIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=CC=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)