Products 1041644-43-2
CAS 1041644-43-2 is the registry number for Nec-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide (CAS 1041644-43-2) is a chemical compound with the molecular formula C15H13ClFN3O and a molecular weight of 305.73 g/mol. IUPAC name: N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide. InChIKey: OVRPUVGBRNDNAS-VIFPVBQESA-N.
| Molecular formula | C15H13ClFN3O |
|---|---|
| Molecular weight | 305.73 g/mol |
| IUPAC name | N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-methylpyrrole-2-carboxamide |
| InChIKey | OVRPUVGBRNDNAS-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1Cl)F)NC(=O)C2=CC=C(N2C)C#N |
Computed by PubChem (NCBI)