CAS 1041870-96-5 is the registry number for 5,5-dimethyl-2-(4-(2-methylpropyl)phenyl)-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 500mg.
5,5-dimethyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazolidine-4-carboxylic acid (CAS 1041870-96-5) is a chemical compound with the molecular formula C16H23NO2S and a molecular weight of 293.4 g/mol. IUPAC name: 5,5-dimethyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazolidine-4-carboxylic acid. InChIKey: MGXVWZNBFYPVBR-UHFFFAOYSA-N.
| Molecular formula | C16H23NO2S |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 5,5-dimethyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | MGXVWZNBFYPVBR-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2NC(C(S2)(C)C)C(=O)O |
Computed by PubChem (NCBI)