Products 10419-65-5
CAS 10419-65-5 appears in our catalog under these names: 2,6-Di-tert-butyl-4-(diphenylamino)phenol, 2,6-Di-tert-butyl-4-(diphenylamino)phenol, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg, 100mg.
2,6-ditert-butyl-4-(N-phenylanilino)phenol (CAS 10419-65-5) is a chemical compound with the molecular formula C26H31NO and a molecular weight of 373.5 g/mol. IUPAC name: 2,6-ditert-butyl-4-(N-phenylanilino)phenol. InChIKey: FVYOUGLYGAJTAC-UHFFFAOYSA-N.
| Molecular formula | C26H31NO |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(N-phenylanilino)phenol |
| InChIKey | FVYOUGLYGAJTAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)