CAS 10419-75-7 appears in our catalog under these names: Propionitrile-d5, 99 atom % D, min 98% Chemical Purity, PROPIONITRILE-D5, 99 ATOM % D. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 0,5g, 0,25g, 5G.
2,2,3,3,3-pentadeuteriopropanenitrile (CAS 10419-75-7) is a chemical compound with the molecular formula C3H5N and a molecular weight of 60.11 g/mol. IUPAC name: 2,2,3,3,3-pentadeuteriopropanenitrile. InChIKey: FVSKHRXBFJPNKK-ZBJDZAJPSA-N.
| Molecular formula | C3H5N |
|---|---|
| Molecular weight | 60.11 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuteriopropanenitrile |
| InChIKey | FVSKHRXBFJPNKK-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C#N |
Computed by PubChem (NCBI)