CAS 1042170-69-3 is the registry number for 6-Bromo-7-iodo-2-naphthalenecarbonitrile. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
6-bromo-7-iodonaphthalene-2-carbonitrile (CAS 1042170-69-3) is a chemical compound with the molecular formula C11H5BrIN and a molecular weight of 357.97 g/mol. IUPAC name: 6-bromo-7-iodonaphthalene-2-carbonitrile. InChIKey: WKDYINYNALGSBZ-UHFFFAOYSA-N.
| Molecular formula | C11H5BrIN |
|---|---|
| Molecular weight | 357.97 g/mol |
| IUPAC name | 6-bromo-7-iodonaphthalene-2-carbonitrile |
| InChIKey | WKDYINYNALGSBZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C=C1C#N)I)Br |
Computed by PubChem (NCBI)